CAS 655255-09-7

4-chlorofuro[3,2-d]pyrimidine

Description:

4-Chlorofuro[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused ring structure, which incorporates both a furan and a pyrimidine moiety. The presence of a chlorine atom at the 4-position of the furo ring contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its unique structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, compounds of this class may exhibit biological activity, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. The compound's molecular formula and weight, along with its spectral characteristics, can be utilized for identification and characterization in research settings. Overall, 4-chlorofuro[3,2-d]pyrimidine represents an interesting subject for further investigation in organic synthesis and drug development.

Formula: C₆H₃ClN₂O

InChI: InChI=1/C6H3ClN2O/c7-6-5-4(1-2-10-5)8-3-9-6/h1-3H

SMILES: c1coc2c1ncnc2Cl

Synonyms:

• Furo[3,2-D]Pyrimidine, 4-Chloro-
• 4-Chlorofuro[3,2-d]pyrimidine

4-Chlorofuro[3,2-d]pyrimidine

CAS: 655255-09-7

Formula: C₆H₃ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.5538

Ref: IN-DA00EICH

4-Chlorofuro[3,2-d]pyrimidine

CAS: 655255-09-7

4-Chlorofuro[3,2-d]pyrimidine

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.55g/mol

Ref: 54-OR301170

4-Chlorofuro[3,2-d]pyrimidine

CAS: 655255-09-7

Formula: C₆H₃ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.55

Ref: 10-F077534