CAS 6555-95-9
:1-methoxy-4-methylbicyclo[2.2.2]octane
Description:
1-Methoxy-4-methylbicyclo[2.2.2]octane, with the CAS number 6555-95-9, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.2]octane framework. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the bicyclic system, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the methoxy group enhances its solubility in organic solvents, while the bicyclic structure provides rigidity and stability. 1-Methoxy-4-methylbicyclo[2.2.2]octane is of interest in various fields, including organic synthesis and fragrance chemistry, due to its potential applications in creating complex molecules and its aromatic properties. Additionally, its molecular structure may influence its reactivity and interaction with other chemical species, making it a subject of study in both academic and industrial research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H18O
InChI:InChI=1/C10H18O/c1-9-3-6-10(11-2,7-4-9)8-5-9/h3-8H2,1-2H3
SMILES:CC12CCC(CC1)(CC2)OC
Synonyms:- Bicyclo[2.2.2]octane, 1-methoxy-4-methyl-
- 1-METHOXY-4-METHYLBICYCLO(2.2.2)OCTANE
- 1-Methoxy-4-methylbicyclo[2.2.2]octane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.