CAS 65550-79-0

2-Bromo-5-chloro-3-pyridinecarboxylic acid

Description:

2-Bromo-5-chloro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with bromine and chlorine atoms, respectively, and at the 3 position with a carboxylic acid functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its properties, such as acidity, stability, and potential interactions with biological targets. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.

Formula: C₆H₃BrClNO₂

InChI: InChI=1S/C6H3BrClNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11)

InChI key: InChIKey=KVUYLDGVNHUHCA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)N=CC(Cl)=C1

Synonyms:

• 2-Bromo-5-chloronicotinic acid
• 3-Pyridinecarboxylic acid, 2-bromo-5-chloro-
• 2-Bromo-5-chloro-3-pyridinecarboxylic acid

2-Bromo-5-chloronicotinic acid

CAS: 65550-79-0

Formula: C₆H₃BrClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.4505

Ref: IN-DA00E9RU

2-Bromo-5-chloronicotinic acid

CAS: 65550-79-0

2-Bromo-5-chloronicotinic acid

Formula: C₆H₃BrClNO₂

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 236.45g/mol

Ref: 54-OR315083

2-Bromo-5-chloronicotinic acid

CAS: 65550-79-0

Formula: C₆H₃BrClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 236.45

Ref: 10-F093578