CAS 65550-81-4

2-Bromo-3-chloro-5-methylpyridine

Description:

2-Bromo-3-chloro-5-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine, chlorine, and a methyl group. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. Typically, this compound appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to the hydrophobic nature of the pyridine ring. The bromine and chlorine atoms introduce electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the methyl group can affect the compound's steric and electronic properties, influencing its reactivity and interactions with other molecules. Due to its unique structure, 2-Bromo-3-chloro-5-methylpyridine may find applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis.

Formula: C₆H₅BrClN

InChI: InChI=1/C6H5BrClN/c1-4-2-5(8)6(7)9-3-4/h2-3H,1H3

SMILES: Cc1cc(c(Br)nc1)Cl

Synonyms:

• 2-Bromo-3-chloro-5-picoline

2-Bromo-3-chloro-5-methylpyridine

CAS: 65550-81-4

Formula: C₆H₅BrClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.4676

Ref: IN-DA0039JD

2-Bromo-3-chloro-5-methylpyridine

CAS: 65550-81-4

2-Bromo-3-chloro-5-methylpyridine

Purity: 98%

Molecular weight: 206.47g/mol

Ref: 54-OR42133

2-Bromo-3-chloro-5-methylpyridine

CAS: 65550-81-4

Formula: C₆H₅BrClN

Purity: 98%+;RG

Color and Shape: Solid

Molecular weight: 206.47

Ref: 10-F067294