CAS 65556-81-2

2,2,7,7-tetramethylhexahydrobenzo[1,2-d:3,4-d']bis[1,3]dioxole-4,5-diol

Description:

2,2,7,7-Tetramethylhexahydrobenzo[1,2-d:3,4-d']bis[1,3]dioxole-4,5-diol, with CAS number 65556-81-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates multiple dioxole rings. This compound features a high degree of substitution with four methyl groups, which contributes to its steric bulk and potentially influences its reactivity and solubility. The presence of hydroxyl (-OH) groups indicates that it may exhibit properties typical of diols, such as hydrogen bonding capabilities, which can affect its physical properties like boiling point and solubility in polar solvents. The compound's structure suggests it may have applications in organic synthesis or materials science, particularly in the development of polymers or as a precursor for more complex chemical entities. However, specific data on its toxicity, stability, and environmental impact would require further investigation, as such information is crucial for understanding its practical applications and safety considerations in various contexts.

Formula: C₁₂H₂₀O₆

InChI: InChI=1/C12H20O6/c1-11(2)15-7-5(13)6(14)8-10(9(7)17-11)18-12(3,4)16-8/h5-10,13-14H,1-4H3

SMILES: CC1(C)OC2C(C(C3C(C2O1)OC(C)(C)O3)O)O

1,2:5,6-Di-O-isopropylidene-L-chiro-inositol

CAS: 65556-81-2

Ref: 7W-GC4680

1,2:5,6-Di-O-isopropylidene-L-chiro-inositol

Controlled Product

CAS: 65556-81-2

Formula: C₁₂H₂₀O₆

Color and Shape: Neat

Molecular weight: 260.284

Ref: TR-D209720

1,2:5,6-Di-O-isopropylidene-L-chiro-inositol

CAS: 65556-81-2

1,2:5,6-Di-O-isopropylidene-L-chiro-inositol is a custom synthesis that can be modified by fluorination, methylation and click modification. The product is a monosaccharide and an oligosaccharide. It is also a synthetic saccharide and a polysaccharide. The product can be glycosylated or sugar modified with carbohydrates such as complex carbohydrate to form 1,2:5,6-Di-O-isopropylidene-L-chiro-inositol.

Formula: C₁₂H₂₀O₆

Purity: Min. 95%

Molecular weight: 260.28 g/mol

Ref: 3D-MD10120