CAS 6556-16-7
:Manganese(II) oxalate dihydrate
Description:
Manganese(II) oxalate dihydrate is an inorganic compound with the formula MnC2O4·2H2O. It appears as a pale pink to light brown crystalline solid and is known for its solubility in water, which increases with temperature. This compound is formed from manganese(II) ions and oxalate ions, and it typically crystallizes in a monoclinic system. Manganese(II) oxalate dihydrate is often used in various applications, including as a precursor in the synthesis of manganese-based materials and in analytical chemistry for the determination of manganese. It exhibits properties typical of transition metal oxalates, such as the ability to form coordination complexes. Additionally, it can decompose upon heating, releasing carbon dioxide and other products. Safety precautions should be taken when handling this compound, as manganese compounds can pose health risks if ingested or inhaled. Overall, manganese(II) oxalate dihydrate is a significant compound in both industrial and laboratory settings due to its unique chemical properties and reactivity.
Formula:C2H4MnO6
InChI:InChI=1/C2H2O4.Mn.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+2;;/p-2
Synonyms:- Manganeseoxalatedihydrate
- Manganese(2+) Ethanedioate Hydrate (1:1:2)
- Manganese oxalate dihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Manganese(II) oxalate dihydrate, Mn 30% min
CAS:<p>As a paint and varnish drier</p>Formula:C2H4MnO6Color and Shape:Crystals or powder or crystalline powder, White to pale pinkMolecular weight:178.99Manganese(II) oxalate dihydrate
CAS:Manganese(II) oxalate dihydrateFormula:MnC2O4H2OPurity:99%Color and Shape: white to red solidMolecular weight:178.99g/molManganese(II) oxalate dihydrate
CAS:Formula:C2H4MnO6Purity:98.0%Color and Shape:Liquid, No data available.Molecular weight:178.986




