CAS 65567-32-0
:(-)-Nirvanol
Description:
(-)-Nirvanol, with the CAS number 65567-32-0, is a chemical compound that belongs to the class of terpenoids, specifically a type of sesquiterpene alcohol. It is characterized by its chiral nature, existing as a single enantiomer, which contributes to its unique biological activity. The compound is typically derived from natural sources, particularly certain plant species, and is known for its potential therapeutic properties, including anti-inflammatory and analgesic effects. (-)-Nirvanol exhibits a complex molecular structure that includes multiple functional groups, which can influence its solubility and reactivity. Its stereochemistry plays a crucial role in its interaction with biological systems, making it a subject of interest in pharmacological research. Additionally, (-)-Nirvanol may possess a distinctive aroma, contributing to its use in perfumery and flavoring applications. Overall, the compound's characteristics make it a valuable subject for further study in both natural product chemistry and medicinal applications.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m1/s1
InChI key:InChIKey=UDTWZFJEMMUFLC-LLVKDONJSA-N
SMILES:C(C)[C@]1(C(=O)NC(=O)N1)C2=CC=CC=C2
Synonyms:- (-)-5-Ethyl-5-phenylhydantoin
- (-)-5-Phenyl-5-ethylhydantoin
- (-)-Nirvanol
- (5R)-5-Ethyl-5-phenyl-2,4-imidazolidinedione
- (5R)-5-Ethyl-5-phenylimidazolidine-2,4-dione
- (R)-5-Ethyl-5-phenyl-2,4-imidazolidinedione
- (R)-5-Ethyl-5-phenylimidazolidine-2,4-dione
- (R)-5-Phenyl-5-ethylhydantoin
- 2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (5R)-
- 2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (R)-
- 2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (R)- (9CI)
- Brn 0085312
- Hydantoin, 5-ethyl-5-phenyl-, (-)-
- Nirvanol, L-
- l-5-Ethyl-5-phenylhydantoin
- l-Nirvanol
- (R)-Nirvanol
- See more synonyms
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(R)-5-Ethyl-5-phenylimidazolidine-2,4-dione
CAS:Formula:C11H12N2O2Color and Shape:SolidMolecular weight:204.2252R-(-)-N-Desmethyl Mephenytoin
CAS:Controlled ProductApplications An anticonvulsant, hypnotic. A metabolite of Mephentoin.
References Knabe, J., et al.: Arch. Phar., 313, 538 (1980)Formula:C11H12N2O2Color and Shape:NeatMolecular weight:204.23R-(-)-N-Desmethyl Mephenytoin Brucine Salt
CAS:Controlled ProductFormula:C11H12N2O2•C23H26N2O4Color and Shape:NeatMolecular weight:598.69


