CAS 65567-34-2
:(+)-Nirvanol
Description:
(+)-Nirvanol, with the CAS number 65567-34-2, is a chemical compound that belongs to the class of organic molecules known as terpenoids. It is characterized by its chiral nature, which means it exists in two enantiomeric forms, with the (+) designation indicating its specific optical activity. This compound is typically derived from natural sources and is known for its potential biological activities, including anti-inflammatory and analgesic properties. The molecular structure of (+)-Nirvanol features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior and interactions. It is often studied in the context of pharmacology and natural product chemistry due to its potential therapeutic applications. Additionally, like many terpenoids, (+)-Nirvanol may exhibit volatility and solubility characteristics that are relevant for its use in various formulations. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate any potential risks associated with its use.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m0/s1
InChI key:InChIKey=UDTWZFJEMMUFLC-NSHDSACASA-N
SMILES:C(C)[C@@]1(C(=O)NC(=O)N1)C2=CC=CC=C2
Synonyms:- (+)-5-Ethyl-5-phenylhydantoin
- (+)-5-Phenyl-5-ethylhydantoin
- (+)-Nirvanol
- (5S)-5-Ethyl-5-phenyl-2,4-imidazolidinedione
- (5S)-5-Ethyl-5-phenylimidazolidine-2,4-dione
- (S)-5-Ethyl-5-phenyl-2,4-imidazolidinedione
- (S)-5-Phenyl-5-ethylhydantoin
- 2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (5S)-
- 2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (S)-
- S-(+)-N-Desmethylmephentoin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
S-(+)-N-Desmethyl Mephenytoin
CAS:Controlled ProductApplications An anticonvulsant, hypnotic. A metabolite of Mephentoin.
References Knabe, J., et al.: Arch. Phar., 313, 538 (1980)Formula:C11H12N2O2Color and Shape:NeatMolecular weight:204.23S-(+)-N-Desmethyl Mephenytoin Brucine Salt
CAS:Controlled ProductFormula:C11H12N2O2•C23H26N2O4Color and Shape:NeatMolecular weight:598.69

