CAS 65591-11-9
:3H-1,2,3-Triazolo[4,5-d]pyrimidine-5,7-diamine, sulfate (1:?)
Description:
3H-1,2,3-Triazolo[4,5-d]pyrimidine-5,7-diamine, sulfate (1:?) is a chemical compound characterized by its unique triazole and pyrimidine ring structure, which contributes to its potential biological activity. This compound features two amino groups at the 5 and 7 positions of the pyrimidine ring, enhancing its reactivity and potential for forming hydrogen bonds, which is significant in biological interactions. The sulfate component indicates that the compound is likely a salt, which can influence its solubility and stability in various solvents. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. The presence of the triazole moiety may also suggest activity related to enzyme inhibition or modulation of biological pathways. As with many nitrogen-containing heterocycles, the compound may exhibit diverse chemical reactivity, making it a subject of interest in synthetic organic chemistry and drug design.
Formula:C4H5N7·xH2O4S
InChI:InChI=1S/C4H5N7.H2O4S/c5-2-1-3(10-11-9-1)8-4(6)7-2;1-5(2,3)4/h(H5,5,6,7,8,9,10,11);(H2,1,2,3,4)
InChI key:InChIKey=WLQDKQQCJXLDGN-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC(N)=N1)N=NN2.S(=O)(=O)(O)O
Synonyms:- 1H-1,2,3-Triazolo(4,5-d)pyrimidine-5,7-diamine, sulfate (2:1)
- 1H-1,2,3-Triazolo[4,5-d]pyrimidine-5,7-diamine, sulfate
- 1H-[1,2,3]Triazolo[4,5-d]pyrimidine-5,7-diamine sulfate (1:1)
- 3H-1,2,3-Triazolo[4,5-d]pyrimidine-5,7-diamine, sulfate (1:?)
- 8-Aza-2,6-diaminopurine sulfate
- v-Triazolo[4,5-d]pyrimidine, 5,7-diamino-, sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
8-Aza-2,6-diaminopurine sulfate (1:x)
CAS:8-Aza-2,6-diaminopurine sulfate (1:x) is a sulfate salt that is soluble in water. The molecular mass of the compound is 581.10 g/mol and it has a molecular formula of C5H7N3O4S. The crystal structure of the compound consists of an asymmetric unit containing one molecule. The 8-aza-2,6-diaminopurine monohydrate salt has a solubility of 1 g/100 mL in water at 25°C. It also has a melting point of 190°C and a boiling point of 340°C.
Formula:C4H5N7·xH2SO4Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:151.13 g/mol
