CAS 65595-02-0

(2S)-1-[(1,1-Dimethylethoxy)carbonyl]-2-pyrrolidinepropanoic acid

Description:

(2S)-1-[(1,1-Dimethylethoxy)carbonyl]-2-pyrrolidinepropanoic acid, identified by its CAS number 65595-02-0, is an organic compound characterized by its pyrrolidine ring structure, which contributes to its cyclic nature and potential for stereoisomerism due to the presence of a chiral center. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its solubility in polar solvents. The presence of the 1,1-dimethylethoxycarbonyl group serves as a protective group for the carboxylic acid, influencing its reactivity and stability during chemical reactions. The compound's stereochemistry, indicated by the (2S) designation, suggests specific spatial arrangements that can affect its biological activity and interactions with other molecules. Overall, this compound may be of interest in pharmaceutical chemistry and organic synthesis, particularly in the development of chiral intermediates or active pharmaceutical ingredients. Its unique structural features and functional groups make it a candidate for various applications in medicinal chemistry and related fields.

Formula: C₁₂H₂₁NO₄

InChI: InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-8-4-5-9(13)6-7-10(14)15/h9H,4-8H2,1-3H3,(H,14,15)/t9-/m0/s1

InChI key: InChIKey=YERVFXLPVTWCHS-VIFPVBQESA-N

SMILES: C(CC(O)=O)[C@H]1N(C(OC(C)(C)C)=O)CCC1

3-[(2S)-1-[(tert-Butoxy)carbonyl]pyrrolidin-2-yl]propanoic acid

CAS: 65595-02-0

Versatile small molecule scaffold

Formula: C₁₂H₂₁NO₄

Purity: Min. 95%

Molecular weight: 243.3 g/mol

Ref: 3D-QCA59502