
CAS 65595-90-6
:N-(6-Aminohexyl)-5-chloro-1-naphthalenesulfonamide
Description:
N-(6-Aminohexyl)-5-chloro-1-naphthalenesulfonamide, with the CAS number 65595-90-6, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a naphthalene ring system, which contributes to its aromatic characteristics and potential interactions in biological systems. The presence of a chloro substituent and a long alkyl chain (6-aminohexyl) enhances its solubility and reactivity, making it suitable for various applications in medicinal chemistry and biochemistry. The amino group can participate in hydrogen bonding and may influence the compound's biological activity, potentially affecting its pharmacokinetics and pharmacodynamics. Additionally, the sulfonamide moiety is often associated with a range of biological activities, including enzyme inhibition. Overall, this compound's unique structure suggests potential utility in drug development, particularly in targeting specific biological pathways or as a scaffold for further chemical modifications. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C16H21ClN2O2S
InChI:InChI=1S/C16H21ClN2O2S/c17-15-9-5-8-14-13(15)7-6-10-16(14)22(20,21)19-12-4-2-1-3-11-18/h5-10,19H,1-4,11-12,18H2
InChI key:InChIKey=IDEHCMNLNCJQST-UHFFFAOYSA-N
SMILES:S(NCCCCCCN)(=O)(=O)C=1C2=C(C(Cl)=CC=C2)C=CC1
Synonyms:- W 7
- W-7
- N-(6-aminohexyl)-5-chloronaphthalene-1-sulfonamide
- W7 (pharmaceutical)
- N-(6-Aminohexyl)-5-chloro-1-naphthalenesulfonamide
- 1-Naphthalenesulfonamide, N-(6-aminohexyl)-5-chloro-
- [6-[[(5-Chloronaphthalen-1-yl)sulfonyl]amino]hexyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
