CAS 656-42-8
:2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
Description:
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde, with the CAS number 656-42-8, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and two fluorine atoms attached to the carbon framework. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the benzene ring. The difluoromethyl group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde functional group is reactive, allowing for various chemical transformations, including condensation and oxidation reactions. Additionally, the presence of fluorine atoms can enhance the compound's lipophilicity and metabolic stability, which are desirable traits in drug design. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde is a valuable compound in synthetic organic chemistry.
Formula:C8H4F2O3
InChI:InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H
SMILES:c1cc2c(cc1C=O)OC(F)(F)O2
Synonyms:- 2,2-Difluoro-5-formyl-1,3-benzodioxole
- 2,2-Difluoro-1,3-Benzodioxole-5-Carbaldehyde
- 2,2-Difluorobenzodioxole-5-Carboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde, 97%
CAS:2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde is used as primary and secondary intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar producFormula:C8H4F2O3Purity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:186.112,2-Difluoro-1,3-benzodioxole-5-carbaldehyde
CAS:Formula:C8H4F2O3Purity:98%Color and Shape:LiquidMolecular weight:186.11242,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
CAS:2,2-Difluoro-1,3-benzodioxole-5-carboxaldehydeFormula:C8H4F2O3Purity:98%Color and Shape: clear. colourless liquidMolecular weight:186.11g/mol2,2-Difluorobenzo[d][1,3]dioxole-5-carbaldehyde
CAS:Formula:C8H4F2O3Purity:97%Color and Shape:LiquidMolecular weight:186.114



