CAS 656-96-2

N-[4-chloro-3-(trifluoromethyl)phenyl]formamide

Description:

N-[4-chloro-3-(trifluoromethyl)phenyl]formamide, with the CAS number 656-96-2, is an organic compound characterized by its distinct functional groups and structural features. It contains a formamide moiety, which is characterized by the presence of a carbonyl group (C=O) directly attached to a nitrogen atom (N). The compound features a phenyl ring substituted with a chlorine atom at the para position and a trifluoromethyl group at the meta position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound is typically used in various chemical syntheses and may exhibit specific interactions in biological systems due to its polar and nonpolar characteristics. Its stability, solubility, and reactivity can vary depending on the solvent and conditions used. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.

Formula: C₈H₅ClF₃NO

InChI: InChI=1/C8H5ClF3NO/c9-7-2-1-5(13-4-14)3-6(7)8(10,11)12/h1-4H,(H,13,14)

SMILES: c1cc(c(cc1N=CO)C(F)(F)F)Cl

N-[4-Chloro-3-(trifluoromethyl)phenyl]formamide

CAS: 656-96-2

Versatile small molecule scaffold

Formula: C₈H₅ClF₃NO

Purity: Min. 95%

Molecular weight: 223.58 g/mol

Ref: 3D-AAA65696