CAS 65603-19-2
:N-[6-(diethylamino)-9-{2-[(octadecyloxy)carbonyl]phenyl}-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride
Description:
N-[6-(diethylamino)-9-{2-[(octadecyloxy)carbonyl]phenyl}-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride, with CAS number 65603-19-2, is a synthetic organic compound characterized by its complex structure, which includes a xanthenylidene core, diethylamino groups, and an octadecyloxycarbonyl substituent. This compound typically exhibits properties such as solubility in organic solvents, which can be attributed to its long hydrophobic alkyl chain, while the presence of the quaternary ammonium group enhances its ionic character and solubility in polar solvents. It may display fluorescence due to the presence of the xanthenylidene moiety, making it potentially useful in applications such as dyes or fluorescent markers. The compound's stability and reactivity can be influenced by the substituents on the xanthenylidene structure, which can affect its electronic properties. Overall, this compound is of interest in various fields, including materials science and biochemistry, due to its unique structural features and potential applications.
Formula:C46H67ClN2O3
InChI:InChI=1/C46H67N2O3.ClH/c1-6-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-34-50-46(49)40-29-26-25-28-39(40)45-41-32-30-37(47(7-2)8-3)35-43(41)51-44-36-38(31-33-42(44)45)48(9-4)10-5;/h25-26,28-33,35-36H,6-24,27,34H2,1-5H3;1H/q+1;/p-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Octadecyl Rhodamine B Chloride
CAS:Formula:C46H67ClN2O3Purity:>95.0%(HPLC)(qNMR)Color and Shape:Orange to Amber to Dark red powder to crystalMolecular weight:731.50Octadecyl Rhodamine B chloride
CAS:Octadecyl Rhodamine B chloridePurity:≥95%Molecular weight:731.49g/molOctadecyl Rhodamine B chloride
CAS:Octadecyl Rhodamine B chloride, also known as RBOE, is a polarity-sensitive dye that is often used as a chromophore with other compounds to stain cell membranes
Formula:C46H67ClN2O3Purity:95%Color and Shape:SoildMolecular weight:731.49




