CAS 65615-22-7

1,4-Dihydro-8-hydroxy-7-(phenylmethoxy)-3H-2-benzopyran-3-one

Description:

1,4-Dihydro-8-hydroxy-7-(phenylmethoxy)-3H-2-benzopyran-3-one, with the CAS number 65615-22-7, is a chemical compound belonging to the class of flavonoids, specifically a type of chromone. This compound features a benzopyran structure, which is characterized by a fused benzene and pyran ring system. The presence of a hydroxy group at the 8-position and a phenylmethoxy group at the 7-position contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The dihydro form indicates that it has a reduced double bond in the benzopyran ring, which may influence its reactivity and stability. This compound is of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 1,4-Dihydro-8-hydroxy-7-(phenylmethoxy)-3H-2-benzopyran-3-one represents a fascinating area of study within the field of natural products and synthetic organic chemistry.

Formula: C₁₆H₁₄O₄

InChI: InChI=1S/C16H14O4/c17-15-8-12-6-7-14(16(18)13(12)10-20-15)19-9-11-4-2-1-3-5-11/h1-7,18H,8-10H2

InChI key: InChIKey=NKRBAZSRXUCUME-UHFFFAOYSA-N

SMILES: OC1=C2C(=CC=C1OCC3=CC=CC=C3)CC(=O)OC2

Synonyms:

• 1,4-Dihydro-8-hydroxy-7-(phenylmethoxy)-3H-2-benzopyran-3-one
• 3H-2-Benzopyran-3-one, 1,4-dihydro-8-hydroxy-7-(phenylmethoxy)-

Berberine Impurity 6

CAS: 65615-22-7

Formula: C₁₆H₁₄O₄

Molecular weight: 270.28

Ref: 4Z-B-2221