CAS 65615-90-9
:4-Amino-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine methyl ester
Description:
4-Amino-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine methyl ester, with the CAS number 65615-90-9, is a synthetic amino acid derivative that features a phenylalanine backbone modified with an amino group and a tert-butoxycarbonyl (Boc) protecting group. This compound is characterized by its ability to participate in peptide synthesis, serving as a building block for the formation of peptides and proteins. The presence of the Boc group provides stability and protection to the amino group during chemical reactions, facilitating selective modifications. The methyl ester functionality enhances the compound's solubility in organic solvents and can influence its reactivity in various chemical processes. Additionally, this compound is of interest in pharmaceutical and biochemical research due to its potential applications in drug design and development. Its structural features contribute to its role in various biochemical pathways and interactions, making it a valuable compound in the field of medicinal chemistry.
Formula:C15H22N2O4
InChI:InChI=1S/C15H22N2O4/c1-15(2,3)21-14(19)17-12(13(18)20-4)9-10-5-7-11(16)8-6-10/h5-8,12H,9,16H2,1-4H3,(H,17,19)/t12-/m0/s1
InChI key:InChIKey=UUSXEIQYCSXKPN-LBPRGKRZSA-N
SMILES:[C@@H](CC1=CC=C(N)C=C1)(NC(OC(C)(C)C)=O)C(OC)=O
Synonyms:- (s)-Methyl 3-(4-aminophenyl)-2-((tert-butoxycarbonyl)amino)propanoate
- Methyl (2S)-3-(4-aminophenyl)-2-[(tert-butoxycarbonyl)amino]propanoate
- L-Phenylalanine, 4-amino-N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester
- 4-Amino-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine Methyl Ester
CAS:Formula:C15H22N2O4Purity:95%Color and Shape:SolidMolecular weight:294.3462(S)-METHYL 3-(4-AMINOPHENYL)-2-((TERT-BUTOXYCARBONYL)AMINO)PROPANOATE
CAS:Formula:C15H22N2O4Purity:95%Color and Shape:SolidMolecular weight:294.3514-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine methyl ester
CAS:4-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine methyl ester is a photoresponsive amino acid that can exist in two forms. The cis form has a trans-azobenzene chromophore and the trans form has an azobenzene chromophore. When exposed to light of appropriate wavelength, the trans form will convert into the cis form. This reversible process is called photoisomerization. 4-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine methyl ester has been used as a biomaterial with applications in the areas of photoresponsive peptides and polymers, as well as for use in biosensors and other lab equipment.Formula:C15H22N2O4Purity:Min. 95%Molecular weight:294.35 g/mol4-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine Methyl Ester
CAS:Controlled ProductFormula:C15H22N2O4Color and Shape:NeatMolecular weight:294.354-Amino-N-(tert-butoxycarbonyl)-L-phenylalanine Methyl Ester
CAS:Formula:C15H22N2O4Molecular weight:294.35





