CAS 65618-21-5

1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)

Description:

1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1), with CAS number 65618-21-5, is a chemical compound characterized by its complex structure that includes a benzopyrylium core and multiple hydroxyl groups. This compound features a positively charged pyrylium ion, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of multiple hydroxyl groups indicates strong hydrogen bonding capabilities, which can influence its solubility and interaction with other molecules. The chloride ion serves as a counterion, balancing the positive charge of the pyrylium moiety. This compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for studies in photochemistry and dye applications. Additionally, the presence of multiple hydroxyl groups suggests potential antioxidant properties, which could be explored in biological contexts. Overall, the unique structural features of this compound make it a subject of interest in various fields of research, including medicinal chemistry and materials science.

Formula: C₁₅H₁₁O₆·Cl

InChI: InChI=1S/C15H10O6.ClH/c16-8-5-10(17)9-1-2-13(21-14(9)6-8)7-3-11(18)15(20)12(19)4-7;/h1-6H,(H4-,16,17,18,19,20);1H

InChI key: InChIKey=MSRWCRMKQPGZND-UHFFFAOYSA-N

SMILES: OC=1C2=C([O+]=C(C=C2)C3=CC(O)=C(O)C(O)=C3)C=C(O)C1.[Cl-]

Synonyms:

• Tricetinidin
• 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
• 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)

Tricetinidin chloride

CAS: 65618-21-5

Tricetinidin chloride is a useful organic compound for research related to life sciences and the catalog number is T124461.

Formula: C₁₅H₁₁ClO₆

Color and Shape: Solid

Molecular weight: 322.7

Ref: TM-T124461