CAS 6562-41-0
:1-Chloro-N,N,N′,N′-tetramethylboranediamine
Description:
1-Chloro-N,N,N′,N′-tetramethylboranediamine, with the CAS number 6562-41-0, is an organoboron compound characterized by the presence of a boron atom bonded to a nitrogen-containing amine structure. This compound features a chloro substituent and four methyl groups attached to the nitrogen atoms, which contribute to its steric and electronic properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the boron atom imparts unique reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis and in the development of boron-containing materials. The compound is known for its potential applications in medicinal chemistry and materials science due to its ability to form stable complexes with various substrates. However, like many organoboron compounds, it may pose certain hazards, necessitating careful handling and storage to ensure safety in laboratory environments.
Formula:C4H12BClN2
InChI:InChI=1S/C4H12BClN2/c1-7(2)5(6)8(3)4/h1-4H3
InChI key:InChIKey=VYAJQQLLLCSMJL-UHFFFAOYSA-N
SMILES:B(N(C)C)(N(C)C)Cl
Synonyms:- 1-Chloro-N,N,N′,N′-tetramethylboranediamine
- Bis(dimethylamino)boron chloride
- Bis(dimethylamino)boryl chloride
- Bis(dimethylamino)chloroborane
- Borane, chlorobis(dimethylamino)-
- Boranediamine, 1-chloro-N,N,N′,N′-tetramethyl-
- Chlorobis(dimethylamino)borane
- Dimethylamine, N,N′-(chloroborylene)bis-
- methanamine, N,N'-(chloroborylene)bis[N-methyl-
- N,N'-(Chloroboranediyl)bis(N-methylmethanamine)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
