CAS 656257-45-3

[4-(4-ethylpiperazin-1-yl)phenyl]-(2-hydroxy-1,1,2-trimethyl-propoxy)borinic acid

Description:

[4-(4-ethylpiperazin-1-yl)phenyl]-(2-hydroxy-1,1,2-trimethyl-propoxy)borinic acid, with CAS number 656257-45-3, is a boronic acid derivative characterized by its unique structural features. This compound contains a boron atom bonded to a hydroxyl group and an alkoxy group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the piperazine moiety enhances its solubility and biological activity, making it a candidate for various pharmaceutical applications. Additionally, the ethyl substituent on the piperazine ring may influence its pharmacokinetic properties. The compound's boronic acid functionality allows for reversible covalent bonding with diols, which is significant in the development of sensors and drug delivery systems. Overall, this compound's structural characteristics suggest potential utility in diverse chemical and biological contexts, particularly in the fields of drug discovery and materials science.

Formula: C₁₈H₃₁BN₂O₃

InChI: InChI=1/C18H31BN2O3/c1-6-20-11-13-21(14-12-20)16-9-7-15(8-10-16)19(23)24-18(4,5)17(2,3)22/h7-10,22-23H,6,11-14H2,1-5H3

SMILES: CCN1CCN(CC1)c1ccc(cc1)B(O)OC(C)(C)C(C)(C)O

4-(4-Ethylpiperazin-1-yl)phenylboronic acid pinacol ester

CAS: 656257-45-3

Formula: C₁₈H₂₉BN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 316.25

Ref: 10-F078454

4-(4-Ethylpiperazin-1-yl)-phenylboronicacidpinacolester

CAS: 656257-45-3

Formula: C₁₈H₂₉BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 316.2461

Ref: IN-DA00FFBG

4-(4-Ethylpiperazin-1-yl)phenylboronic acid pinacol ester

CAS: 656257-45-3

4-(4-Ethylpiperazin-1-yl)phenylboronic acid pinacol ester

Purity: 99%

Molecular weight: 316.25g/mol

Ref: 54-OR73180