CAS 6563-13-9

6-methoxyquinoline N-oxide

Description:

6-Methoxyquinoline N-oxide is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a methoxy group (-OCH3) at the 6-position of the quinoline ring contributes to its chemical properties, including its solubility and reactivity. As an N-oxide, it features an oxygen atom bonded to the nitrogen atom of the quinoline, which can influence its electronic properties and reactivity, making it a potential candidate for various chemical reactions, including oxidation processes. This compound is often used in research and development, particularly in the fields of medicinal chemistry and organic synthesis, due to its biological activity and ability to act as a ligand in coordination chemistry. Additionally, 6-methoxyquinoline N-oxide may exhibit fluorescence properties, making it useful in analytical applications. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-13-9-4-5-10-8(7-9)3-2-6-11(10)12/h2-7H,1H3

SMILES: COc1ccc2c(cccn2=O)c1

Synonyms:

• 6-Methoxyquinoline 1-Oxide

6-Methoxyquinoline N-Oxide

CAS: 6563-13-9

Formula: C₁₀H₉NO₂

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Orange powder to crystal

Molecular weight: 175.19

Ref: 3B-M2999

6-Methoxyquinolin N-oxide

CAS: 6563-13-9

Formula: C₁₀H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA0036V0

6-Methoxyquinoline N-oxide

CAS: 6563-13-9

6-Methoxyquinoline N-oxide

Purity: 97%

Molecular weight: 175.18g/mol

Ref: 54-OR61336

6-Methoxyquinoline 1-oxide

CAS: 6563-13-9

Purity: 98%(LC-MS);RG

Molecular weight: 175.1869965

Ref: 10-F626569