CAS 6567-34-6
:3-(3-bromo-1,2-oxazol-5-yl)propanoic acid
Description:
3-(3-bromo-1,2-oxazol-5-yl)propanoic acid, with the CAS number 6567-34-6, is an organic compound characterized by the presence of a propanoic acid moiety and a 3-bromo-1,2-oxazole ring. This compound features a bromine atom, which contributes to its reactivity and potential applications in various chemical reactions. The oxazole ring is a five-membered heterocyclic structure containing both nitrogen and oxygen, which imparts unique electronic properties and can influence the compound's biological activity. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in acid-base reactions. The presence of the bromine substituent can enhance the compound's lipophilicity and may affect its solubility in organic solvents. Overall, this compound may be of interest in medicinal chemistry and materials science due to its structural features and potential reactivity, making it a candidate for further research and application in synthetic chemistry.
Formula:C6H6BrNO3
InChI:InChI=1/C6H6BrNO3/c7-5-3-4(11-8-5)1-2-6(9)10/h3H,1-2H2,(H,9,10)
SMILES:C(CC(=O)O)c1cc(Br)no1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
