CAS 6567-35-7

3-bromo-1,2-oxazole-5-carboxylic acid

Description:

3-Bromo-1,2-oxazole-5-carboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom, an oxazole ring, and a carboxylic acid functional group. The oxazole ring consists of a five-membered aromatic structure containing both nitrogen and oxygen atoms, which contributes to its unique chemical properties. The bromine substituent at the 3-position enhances the compound's reactivity, making it useful in various synthetic applications. The carboxylic acid group at the 5-position provides acidic properties, allowing for potential interactions in biochemical processes or as a precursor in organic synthesis. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, 3-bromo-1,2-oxazole-5-carboxylic acid is a versatile compound with significant implications in chemical research.

Formula: C₄H₂BrNO₃

InChI: InChI=1/C4H2BrNO3/c5-3-1-2(4(7)8)9-6-3/h1H,(H,7,8)

SMILES: c1c(C(=O)O)onc1Br

Synonyms:

• 5-Isoxazolecarboxylic acid, 3-bromo-

3-Bromoisoxazole-5-carboxylic acid

CAS: 6567-35-7

Formula: C₄H₂BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.9676

Ref: IN-DA00FA2G

3-Bromoisoxazole-5-carboxylic acid

CAS: 6567-35-7

3-Bromoisoxazole-5-carboxylic acid

Purity: 98%

Color and Shape: Off-White Solid

Molecular weight: 191.97g/mol

Ref: 54-OR18624

3-Bromoisoxazole-5-carboxylic acid

CAS: 6567-35-7

Formula: C₄H₂BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.968

Ref: 10-F066203