CAS 65673-86-1

7-methyl-2,3-dihydro-1H-indole

Description:

7-Methyl-2,3-dihydro-1H-indole is a bicyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a methyl group at the 7-position of the indole framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the dihydro group indicates that it has two additional hydrogen atoms compared to the fully aromatic indole, which can influence its reactivity and stability. 7-Methyl-2,3-dihydro-1H-indole may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. The compound's molecular structure allows for various potential interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and applied chemistry.

Formula: C₉H₁₁N

InChI: InChI=1/C9H11N/c1-7-3-2-4-8-5-6-10-9(7)8/h2-4,10H,5-6H2,1H3

SMILES: Cc1cccc2CCNc12

Synonyms:

• 1H-indole, 2,3-dihydro-7-methyl-
• 7-Methylindoline

1H-Indole, 2,3-dihydro-7-methyl-

CAS: 65673-86-1

Formula: C₉H₁₁N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 133.1903

Ref: IN-DA00IBIN

7-Methylindoline

CAS: 65673-86-1

7-Methylindoline

Purity: 98%

Molecular weight: 133.19g/mol

Ref: 54-OR913234

7-Methylindoline

CAS: 65673-86-1

Formula: C₉H₁₁N

Purity: 98%

Molecular weight: 133.194

Ref: 10-F233309