CAS 65676-21-3
:α-(4-Chlorophenyl)-α-[2-(dimethylamino)ethyl]-2-pyridineacetonitrile
Description:
α-(4-Chlorophenyl)-α-[2-(dimethylamino)ethyl]-2-pyridineacetonitrile, identified by its CAS number 65676-21-3, is a chemical compound that features a pyridine ring, a nitrile group, and a dimethylaminoethyl side chain. This compound is characterized by its aromatic structure, which contributes to its potential biological activity. The presence of the 4-chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The dimethylamino group may impart basic properties, allowing for protonation under certain conditions, which can affect solubility and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its synthesis and characterization involve standard organic chemistry techniques, and it may exhibit specific reactivity patterns typical of nitriles and amines. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a class of molecules that may have significant implications in drug development and research.
Formula:C17H18ClN3
InChI:InChI=1S/C17H18ClN3/c1-21(2)12-10-17(13-19,16-5-3-4-11-20-16)14-6-8-15(18)9-7-14/h3-9,11H,10,12H2,1-2H3
InChI key:InChIKey=XWFSLFHFPQWKNV-UHFFFAOYSA-N
SMILES:C(CCN(C)C)(C#N)(C1=CC=C(Cl)C=C1)C2=CC=CC=N2
Synonyms:- 2-(4-Chlorophenyl)-4-(Dimethylamino)-2-(Pyridin-2-Yl)Butanenitrile
- 2-(4-Chlorophenyl)-4-(dimethylamino)-2-pyridin-2-ylbutanenitrile
- 2-Pyridineacetonitrile, α-(4-chlorophenyl)-α-[2-(dimethylamino)ethyl]-
- 2-Pyridineacetonitrile, α-(p-chlorophenyl)-α-[2-(dimethylamino)ethyl]-
- alpha-(4-Chlorophenyl)-alpha-(2-(dimethylamino)ethyl)pyridine-2-acetonitrile
- α-(4-Chlorophenyl)-α-[2-(dimethylamino)ethyl]-2-pyridineacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Chlorphenamine EP Impurity D Maleate
CAS:Formula:C17H18ClN3·C4H4O4Color and Shape:Pale Red SolidMolecular weight:299.80 116.07Chlorpheniramine Nitrile
CAS:Controlled ProductImpurity Chlorpeniramine EP Impurity D
Applications Chlorpheniramine Nitrile (Chlorpeniramine EP Impurity D) is a Chlorpheniramine (C424300) impurity.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C17H18ClN3Color and Shape:Colourless To Light YellowMolecular weight:299.8Chlorphenamine EP Impurity D maleate salt
CAS:Chlorpheniramine nitrile is the nitrile derivative of chlorpheniramine. The decyanation reaction was carried out with potassium hydroxide and chlorpheniramine, then the resulting potassium nitriles were hydrolyzed using acid to yield the desired product. Chlorpheniramine nitrile has a potent anti-histaminic effect that is used for the treatment of allergies or anaphylaxis.
Formula:C17H18ClN3Purity:Min. 95%Molecular weight:299.8 g/mol


