CAS 65691-00-1
:Triarathene
Description:
Triarathene, identified by the CAS number 65691-00-1, is a synthetic organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It is characterized by its complex molecular structure, which typically includes multiple fused aromatic rings. Triarathene is known for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs), due to its favorable electronic properties. The compound exhibits notable fluorescence and can be used as a fluorescent probe in various chemical and biological applications. Additionally, like many PAHs, Triarathene may possess environmental persistence and potential toxicity, necessitating careful handling and assessment of its ecological impact. Its solubility and stability in different solvents can vary, influencing its behavior in various chemical reactions and applications. Overall, Triarathene represents a significant interest in materials science and organic chemistry, particularly in the development of advanced electronic materials.
Formula:C22H15ClS
InChI:InChI=1S/C22H15ClS/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H
InChI key:InChIKey=JWXZLCFGVKMEEK-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C2=CC(=C(S2)C3=CC=CC=C3)C4=CC=CC=C4)C=C1
Synonyms:- 65691-00-1
- triarathene
- Triarathene
- Micromite
- 5-(4-Chlorophenyl)-2,3-diphenylthiophene
- thiophene, 5-(4-chlorophenyl)-2,3-diphenyl-
- 5-(4′-Chlorophenyl)-2,3-diphenylthiophene
- Thiophene, 5-(4-chlorophenyl)-2,3-diphenyl-
- 5-(4-Chlorphenyl)-2,3-diphenylthiophen
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Triarathene
CAS:<p>Triarathene is an anticancer drug that functions as a kinase inhibitor, preventing the activation of proteins involved in cancer cell growth and division. It has been shown to induce apoptosis (programmed cell death) in tumor cells, making it a promising candidate for cancer treatment. Triarathene is an analog of ghrelin, a hormone that regulates appetite and energy balance, and has been isolated from Chinese urine. It selectively inhibits several kinases involved in cancer cell signaling pathways, making it a potent anticancer agent. In addition to its direct effects on cancer cells, Triarathene has been shown to have anti-inflammatory properties and may help to reduce tumor-associated inflammation. Overall, Triarathene represents a promising new approach to treating cancer and improving patient outcomes.</p>Formula:C22H15ClSPurity:Min. 95%Molecular weight:346.9 g/mol
