CAS 657-63-6

N-[2-chloro-5-(trifluoromethyl)phenyl]formamide

Description:

N-[2-chloro-5-(trifluoromethyl)phenyl]formamide, with the CAS number 657-63-6, is an organic compound characterized by its unique functional groups and structural features. It contains a formamide group, which is indicative of its potential reactivity and solubility properties. The presence of a chloro substituent and a trifluoromethyl group on the phenyl ring significantly influences its chemical behavior, including its polarity and lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its trifluoromethyl group often imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the chlorine atom can enhance the compound's reactivity in nucleophilic substitution reactions. Safety considerations should be taken into account due to the presence of halogenated groups, which can pose environmental and health risks. Overall, N-[2-chloro-5-(trifluoromethyl)phenyl]formamide is a compound of interest in synthetic chemistry and material science.

Formula: C₈H₅ClF₃NO

InChI: InChI=1/C8H5ClF3NO/c9-6-2-1-5(8(10,11)12)3-7(6)13-4-14/h1-4H,(H,13,14)

SMILES: c1cc(c(cc1C(F)(F)F)N=CO)Cl

N-Formyl 2-chloro-5-trifluoromethylaniline

CAS: 657-63-6

Formula: C₈H₅ClF₃NO

Molecular weight: 223.5796

Ref: IN-DA003T19

4-Chloro-3-formamidobenzotrifluoride

CAS: 657-63-6

4-Chloro-3-formamidobenzotrifluoride

Purity: ≥95%

Molecular weight: 223.58g/mol

Ref: 54-PC8143