CAS 65706-99-2
:Z-D-glutamic acid 1-benzyl ester
Description:
Z-D-glutamic acid 1-benzyl ester is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features a protective Z (benzyloxycarbonyl) group on the amino group, which enhances its stability and solubility in organic solvents. The presence of the benzyl ester group at the carboxylic acid position further modifies its reactivity and solubility characteristics. Z-D-glutamic acid 1-benzyl ester is typically used in peptide synthesis and as an intermediate in the preparation of more complex molecules. It exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including esterification and amidation. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential for hydrolysis of the ester group in the presence of moisture. Its applications in research and pharmaceuticals highlight its importance in the development of peptide-based therapeutics and other bioactive compounds.
Formula:C20H21NO6
InChI:InChI=1/C20H21NO6/c22-18(23)12-11-17(19(24)26-13-15-7-3-1-4-8-15)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,22,23)/t17-/m1/s1
SMILES:c1ccc(cc1)COC(=O)[C@@H](CCC(=O)O)N=C(O)OCc1ccccc1
Synonyms:- N-cbz-D-glutamic acid A-benzyl ester
- Z-D-Glu-OBzl
- (4R)-5-(benzyloxy)-4-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid (non-preferred name)
- N-Cbz-D-glutamic acid alpha-benzyl ester
- Cbz-D-glutamic acid 1-benzyl ester
- Cbz-D-Glu-Obzl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Benzyl N-Benzyloxycarbonyl-D-glutamate
CAS:Formula:C20H21NO6Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:371.39N-Benzyloxycarbonyl-D-glutamic acid 1-benzyl ester, 97%
CAS:N-Benzyloxycarbonyl-D-glutamic acid 1-benzyl ester, is used as a reagent in the synthesis of acyl peptides that act as immunostimulants. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the l
Formula:C20H21NO6Purity:97%Molecular weight:371.39N-Cbz-D-glutamic acid α-benzyl ester
CAS:Formula:C20H21NO6Purity:98%Color and Shape:SolidMolecular weight:371.3838Z-D-Glu-OBzl
CAS:Formula:C20H21NO6Purity:(HPLC) ≥ 98.0%Color and Shape:White to almost white powder or crystalsMolecular weight:371.39N-[(Phenylmethoxy)carbonyl]-D-glutamic Acid 1-(Phenylmethyl) Ester
CAS:Controlled ProductApplications This compound is used as a reagent in the synthesis of acyl peptides that act as immunostimulants.
References Takeno, H. et al.: Chem. Pharm. Bull., 32, 2932 (1984);Formula:C21H20NO6Color and Shape:NeatMolecular weight:371.38






