CAS 65709-27-5

Piperazine, 2-(2-methoxyphenyl)-

Description:

Piperazine, 2-(2-methoxyphenyl)-, also known by its CAS number 65709-27-5, is a chemical compound that belongs to the piperazine family, characterized by a six-membered ring containing two nitrogen atoms. This compound features a methoxyphenyl group, which contributes to its unique properties and potential biological activities. Typically, piperazine derivatives are known for their applications in pharmaceuticals, particularly as anxiolytics, antidepressants, and antipsychotics. The presence of the methoxy group can influence the compound's solubility, lipophilicity, and overall pharmacological profile. In terms of physical properties, piperazine derivatives often exhibit moderate to high melting points and are generally soluble in polar solvents. The compound's structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature reviews.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1S/C11H16N2O/c1-14-11-5-3-2-4-9(11)10-8-12-6-7-13-10/h2-5,10,12-13H,6-8H2,1H3

InChI key: InChIKey=XYMDIQVPOIVJPF-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)C2CNCCN2

Synonyms:

• 2-(2-Methoxyphenyl)piperazin
• Piperazine, 2-(2-Methoxyphenyl)-
• 2-(2-Methoxyphenyl)Piperazine

2-(2-Methoxyphenyl)piperazine

CAS: 65709-27-5

Formula: C₁₁H₁₆N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 192.2575

Ref: IN-DA003ESB

2-(2-Methoxyphenyl)piperazine

CAS: 65709-27-5

2-(2-Methoxyphenyl)piperazine

Purity: 96%

Molecular weight: 192.26g/mol

Ref: 54-OR84996

2-(2-methoxyphenyl)piperazine

CAS: 65709-27-5

Formula: C₁₁H₁₆N₂O

Purity: 96%

Molecular weight: 192.262

Ref: 10-F526294

2-(2-Methoxyphenyl)-piperazine

CAS: 65709-27-5

2-(2-Methoxyphenyl)-piperazine is a piperazine derivative that binds to the serotonin transporter and blocks its function. It has been shown to have affinity for the serotonin transporter in radioligand binding assays, with an IC50 of 0.8 μM. 2-(2-Methoxyphenyl)-piperazine also acts as an antagonist at the 5-HT1A receptor, with an EC50 of 1.0 μM. This compound has optimal activity at a cycloalkyl group length of 4-6 carbon atoms and is a potent antagonist, with an IC50 of 0.3 μM.

Formula: C₁₁H₁₆N₂O

Purity: Min. 95%

Molecular weight: 192.26 g/mol

Ref: 3D-QCA70927