CAS 65710-57-8
:(S)-2-[(tert-Butoxycarbonyl)amino]-3-(benzyloxycarbonylamino)propionic acid
Description:
(S)-2-[(tert-Butoxycarbonyl)amino]-3-(benzyloxycarbonylamino)propionic acid, with CAS number 65710-57-8, is a synthetic amino acid derivative commonly used in peptide synthesis and pharmaceutical research. This compound features a chiral center, which contributes to its stereochemical properties, making it important in the development of biologically active molecules. The tert-butoxycarbonyl (Boc) and benzyloxycarbonyl (Z) groups serve as protective groups for the amino functionalities, facilitating selective reactions during synthesis. The presence of these groups enhances the compound's stability and solubility in organic solvents. Additionally, the propionic acid backbone provides acidity, which can influence its reactivity and interactions in biological systems. This compound is typically utilized in the preparation of peptides and can play a role in drug design, particularly in the development of therapeutics targeting specific biological pathways. Its structural complexity and functional groups make it a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C16H22N2O6
InChI:InChI=1/C16H22N2O6/c1-16(2,3)24-15(22)18-12(13(19)20)9-17-14(21)23-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,18,22)(H,19,20)/t12-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CN=C(O)OCc1ccccc1)C(=O)O)O
Synonyms:- N-[(tert-Butoxy)carbonyl]-3-[[(phenylmethoxy)carbonyl]amino]-L-alanine
- Boc-Dap(Cbz)-OH
- 3-{[(benzyloxy)carbonyl]amino}-N-(tert-butoxycarbonyl)-L-alanine
- Boc-Dap(Z)-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N3-CBZ-(2S)-N2-Boc-2,3-Diaminopropionic acid
CAS:N3-CBZ-(2S)-N2-Boc-2,3-Diaminopropionic acidPurity:98%Molecular weight:338.36g/molBoc-N3-Cbz- L-2,3-diaminopropionic acid
CAS:Formula:C16H22N2O6Purity:95%Color and Shape:SolidMolecular weight:338.36Boc-Dap (Z)-OH
CAS:Boc-Dap (Z)-OH is a tert-butyl ester of dipeptide that has been synthesized as a mimetic of the natural amino acid L-dap, which is an important component of the precursor molecule for the synthesis of polyamides. The Boc-Dap (Z)-OH is synthesized by reacting dodecane with a mixture of t-Boc protected α,α'-diaminoethane and t-Boc protected N,N'-diisopropylcarbodiimide hydrochloride. This reaction produces Boc-Dap (Z)-OH in high yield with an excellent purity.
Formula:C16H22N2O6Purity:Min. 95%Molecular weight:338.36 g/mol



