CAS 65717-98-8
:N-(Carboxymethyl)-N-[2-oxo-2-[(2,4,6-trimethylphenyl)amino]ethyl]glycine
Description:
N-(Carboxymethyl)-N-[2-oxo-2-[(2,4,6-trimethylphenyl)amino]ethyl]glycine, identified by its CAS number 65717-98-8, is an organic compound characterized by its complex structure, which includes both carboxymethyl and amino functionalities. This substance typically exhibits properties associated with amino acids and their derivatives, such as solubility in polar solvents and potential reactivity due to the presence of functional groups. The compound's structure suggests it may participate in various chemical reactions, including those typical of amines and carboxylic acids, making it useful in synthetic organic chemistry. Additionally, the presence of the bulky 2,4,6-trimethylphenyl group may influence its steric properties and reactivity. This compound could have applications in pharmaceuticals, biochemistry, or as a reagent in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed, as with any chemical substance, due to potential hazards associated with its use.
Formula:C15H20N2O5
InChI:InChI=1S/C15H20N2O5/c1-9-4-10(2)15(11(3)5-9)16-12(18)6-17(7-13(19)20)8-14(21)22/h4-5H,6-8H2,1-3H3,(H,16,18)(H,19,20)(H,21,22)
InChI key:InChIKey=ZGXLCJXTSSBXPZ-UHFFFAOYSA-N
SMILES:N(C(CN(CC(O)=O)CC(O)=O)=O)C1=C(C)C=C(C)C=C1C
Synonyms:- N-(2,4,6-Trimethylphenylcarbamoylmethyl)iminodiacetic acid
- Glycine, N-(carboxymethyl)-N-[2-oxo-2-[(2,4,6-trimethylphenyl)amino]ethyl]-
- N-(Carboxymethyl)-N-[2-oxo-2-[(2,4,6-trimethylphenyl)amino]ethyl]glycine
- 2,2′-(2-(Mesitylamino)-2-oxoethylazanediyl)diacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
