CAS 65733-17-7
:2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester, [R-(E,E)]-
Description:
2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester, with the CAS number 65733-17-7, is an organic compound characterized by its ester functional group and a complex hydrocarbon chain. This substance features a dodecadienoic acid backbone, indicating the presence of two double bonds within a twelve-carbon chain. The presence of methoxy and trimethyl groups suggests that it has specific branching and functional modifications that can influence its physical and chemical properties, such as solubility and reactivity. Typically, esters like this compound are known for their pleasant aromas and are often used in flavoring and fragrance applications. Additionally, the stereochemistry indicated by the [R-(E,E)] notation suggests specific spatial arrangements of the substituents around the double bonds, which can affect the compound's biological activity and interactions. Overall, this compound's unique structure may contribute to its potential applications in various fields, including biochemistry and materials science.
Formula:C19H34O3
InChI:InChI=1S/C19H34O3/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7/h8,11,14-16H,9-10,12-13H2,1-7H3/b11-8+,17-14+/t16-/m0/s1
InChI key:InChIKey=NFGXHKASABOEEW-UQHDCKCOSA-N
SMILES:C(=C(/C=C/C[C@@H](CCCC(OC)(C)C)C)\C)\C(OC(C)C)=O
Synonyms:- ZR 1020
- 2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester, [R-(E,E)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(7R)-Methoprene
CAS:<p>(7R)-Methoprene is an analog of the insect hormone juvenile hormone, which acts as a kinase inhibitor. It has been shown to have potential anticancer properties by inducing apoptosis in cancer cells. (7R)-Methoprene inhibits the activity of kinases such as cyclin-dependent kinases, which are involved in regulating the cell cycle and promoting cell division. This inhibition leads to a decrease in protein synthesis and ultimately induces apoptosis in tumor cells. Studies have shown that (7R)-Methoprene is effective against various human cancer cell lines, including Chinese hamster ovary cells and urine-derived bladder cancer cells. It has also been found to have potential as an inhibitor for other kinases involved in cancer progression. Overall, (7R)-Methoprene shows promise as a novel anticancer agent with a unique mechanism of action.</p>Formula:C19H34O3Purity:Min. 95%Molecular weight:310.5 g/molRef: 4Z-M-123003
Discontinued product


