CAS 65735-71-9
:4-Chloro-3-(trifluoromethyl)benzyl alcohol
Description:
4-Chloro-3-(trifluoromethyl)benzyl alcohol is an organic compound characterized by its aromatic structure, featuring a benzyl alcohol moiety with a chloro group and a trifluoromethyl group attached to the benzene ring. The presence of the chloro substituent introduces a degree of polarity and can influence the compound's reactivity and solubility in various solvents. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's acidity and affect its interaction with other chemical species. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals and agrochemicals. Safety considerations include handling it with care due to potential toxicity and environmental impact, as well as ensuring proper storage to maintain its stability. Overall, 4-Chloro-3-(trifluoromethyl)benzyl alcohol is a valuable compound in chemical research and industrial applications.
Formula:C8H6ClF3O
InChI:InChI=1/C8H6ClF3O/c9-7-2-1-5(4-13)3-6(7)8(10,11)12/h1-3,13H,4H2
SMILES:c1cc(c(cc1CO)C(F)(F)F)Cl
Synonyms:- 4-Chloro-3-trifluoromethylbenzylalcohol
- [4-Chloro-3-(Trifluoromethyl)Phenyl]Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4-Chloro-3-(trifluoromethyl)phenyl)methanol
CAS:Formula:C8H6ClF3OPurity:97%Color and Shape:SolidMolecular weight:210.58084-Chloro-3-(trifluoromethyl)benzyl alcohol
CAS:4-Chloro-3-(trifluoromethyl)benzyl alcoholFormula:C8H6ClF3OPurity:≥95%Color and Shape: off-white fused solidMolecular weight:210.58g/mol3-Chloro-4-(trifluoromethyl)benzyl alcohol
CAS:3-Chloro-4-(trifluoromethyl)benzyl alcohol is a versatile building block for synthesis of various chemical compounds. It is used as a reagent, reaction component, or building block in organic synthesis. It is also useful as a speciality chemical or research chemical. CAS No. 65735-71-9Formula:C8H6ClF3OPurity:Min. 95%Color and Shape:PowderMolecular weight:210.58 g/mol4-Chloro-3-(trifluoromethyl)benzyl alcohol
CAS:Formula:C8H6ClF3OPurity:98%Color and Shape:SolidMolecular weight:210.58



