CAS 657391-86-1

8-methoxy-2-methylquinolin-4-amine

Description:

8-Methoxy-2-methylquinolin-4-amine, identified by its CAS number 657391-86-1, is a chemical compound that belongs to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features a methoxy group (-OCH3) at the 8-position and a methyl group (-CH3) at the 2-position of the quinoline ring, along with an amino group (-NH2) at the 4-position. These functional groups contribute to its chemical reactivity and potential biological activity. The presence of the methoxy group can enhance lipophilicity, potentially influencing the compound's solubility and permeability in biological systems. Additionally, the amino group may participate in hydrogen bonding and can be protonated under acidic conditions, affecting the compound's overall charge and reactivity. 8-Methoxy-2-methylquinolin-4-amine may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1/C11H12N2O/c1-7-6-9(12)8-4-3-5-10(14-2)11(8)13-7/h3-6H,1-2H3,(H2,12,13)

SMILES: Cc1cc(c2cccc(c2n1)OC)N

Synonyms:

• 4-Quinolinamine, 8-Methoxy-2-Methyl-

4-Amino-8-methoxy-2-methylquinoline

CAS: 657391-86-1

4-Amino-8-methoxy-2-methylquinoline

Formula: C₁₁H₁₂N₂O

Purity: ≥95%

Color and Shape: faint to light beige powder

Molecular weight: 188.23g/mol

Ref: 54-OR307958