CAS 65749-30-6

Acetic acid, 2-iodo-, lithium salt (1:1)

Description:

Acetic acid, 2-iodo-, lithium salt (1:1), with the CAS number 65749-30-6, is a chemical compound that features a lithium cation paired with the anion derived from 2-iodoacetic acid. This substance is characterized by its ionic nature, resulting from the interaction between the lithium ion and the anionic form of 2-iodoacetic acid. It typically appears as a white to off-white solid and is soluble in polar solvents due to its ionic characteristics. The presence of the iodine atom in the acetic acid structure can influence its reactivity and potential applications, particularly in organic synthesis and medicinal chemistry. As a lithium salt, it may exhibit unique properties such as enhanced stability and solubility compared to its non-salt counterparts. Additionally, the compound may be utilized in various chemical reactions, including nucleophilic substitutions, due to the reactivity of the iodine substituent. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₂H₃IO₂·Li

InChI: InChI=1S/C2H3IO2.Li/c3-1-2(4)5;/h1H2,(H,4,5);

InChI key: InChIKey=LEKSSIYFKUNLLR-UHFFFAOYSA-N

SMILES: C(CI)(O)=O.[Li]

Synonyms:

• Acetic acid, 2-iodo-, lithium salt (1:1)
• Lithium iodoacetate
• Acetic acid, iodo-, lithium salt

Lithium iodoacetate

CAS: 65749-30-6

Lithium iodoacetate

Purity: 99%

Color and Shape: Solid

Molecular weight: 191.88g/mol

Ref: 54-IN2361