CymitQuimica logo

CAS 65766-32-7

:

4-Chloro-6-methylaminopyrimidine

Description:
4-Chloro-6-methylaminopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom at the 4-position and a methylamino group at the 6-position. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various bioactive compounds. The presence of the chlorine atom enhances its reactivity, while the methylamino group can participate in hydrogen bonding, influencing its interaction with biological targets. Additionally, 4-Chloro-6-methylaminopyrimidine may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact. Overall, this compound exemplifies the diverse chemistry of substituted pyrimidines and their relevance in various chemical applications.
Formula:C5H6ClN3
InChI:InChI=1S/C5H6ClN3/c1-7-5-2-4(6)8-3-9-5/h2-3H,1H3,(H,7,8,9)
InChI key:WZVLJUBTIWFTIE-UHFFFAOYSA-N
SMILES:CNC1=CC(=NC=N1)Cl
Synonyms:
  • (6-Chloro-pyrimidin-4-yl)-methyl-amine
  • 6-Chloro-N-methylpyrimidin-4-amine
Found 4 products.