CAS 6582-31-6
:3-[[3-(dodecylamino)propyl]amino]butyric acid
Description:
3-[[3-(Dodecylamino)propyl]amino]butyric acid, with the CAS number 6582-31-6, is an organic compound characterized by its long hydrophobic dodecyl chain and a hydrophilic amino acid structure. This amphiphilic nature allows it to interact with both lipid and aqueous environments, making it useful in various applications, including surfactants and emulsifiers. The presence of multiple amine groups contributes to its potential as a cationic surfactant, which can enhance its ability to form micelles and stabilize emulsions. The butyric acid moiety provides acidic properties, which can influence solubility and reactivity in different pH environments. Additionally, the compound's long alkyl chain can enhance its ability to penetrate biological membranes, suggesting potential applications in drug delivery systems. Overall, its unique structure imparts significant versatility in both industrial and pharmaceutical contexts, although specific applications would depend on further empirical studies and formulations.
Formula:C19H40N2O2
InChI:InChI=1/C19H40N2O2/c1-3-4-5-6-7-8-9-10-11-12-14-20-15-13-16-21-18(2)17-19(22)23/h18,20-21H,3-17H2,1-2H3,(H,22,23)
Synonyms:- 3-[[3-(dodecylamino)propyl]amino]butyric acid
- Dapabutan
- 3-((3-(Dodecylamino)propyl)amino)butanoic acid
- Butanoic acid, 3-[[3-(dodecylamino)propyl]amino]-
- Dodecylaminopropyl-beta-aminobutyric acid
- Dapabutan [INN]
- UNII-1R0Y7O07NF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
