CAS 6584-12-9

diamino-N-[(4-methylphenyl)sulfonyl]methaniminium

Description:

Diamino-N-[(4-methylphenyl)sulfonyl]methaniminium, with the CAS number 6584-12-9, is a chemical compound characterized by its unique structure that includes a methaniminium core substituted with two amino groups and a sulfonyl group attached to a para-methylphenyl moiety. This compound typically exhibits properties associated with both amines and sulfonamides, which may influence its solubility, reactivity, and potential applications. The presence of the sulfonyl group often imparts enhanced stability and can affect the compound's interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the methyl group on the phenyl ring can influence the electronic properties and steric hindrance, potentially affecting its reactivity and binding affinity in various chemical reactions. Overall, this compound may be explored for its utility in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₈H₁₂N₃O₂S

InChI: InChI=1/C8H11N3O2S/c1-6-2-4-7(5-3-6)14(12,13)11-8(9)10/h2-5H,1H3,(H4,9,10,11)/p+1

InChI key: YMXFYAAVYBVOKE-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)S(=O)(=O)N=C(N)N