CAS 6584-58-3
:1,4-bis(pyridin-2-ylmethyl)piperazine
Description:
1,4-bis(pyridin-2-ylmethyl)piperazine, with the CAS number 6584-58-3, is a chemical compound characterized by its piperazine core substituted with two pyridin-2-ylmethyl groups. This structure imparts unique properties, including potential biological activity, making it of interest in medicinal chemistry and drug development. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to the presence of nitrogen atoms in both the piperazine and pyridine rings, which can engage in hydrogen bonding. Its molecular structure allows for various interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the presence of multiple nitrogen atoms may contribute to its basicity, affecting its reactivity and interaction with other chemical species. Overall, 1,4-bis(pyridin-2-ylmethyl)piperazine is notable for its structural complexity and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C16H20N4
InChI:InChI=1/C16H20N4/c1-3-7-17-15(5-1)13-19-9-11-20(12-10-19)14-16-6-2-4-8-18-16/h1-8H,9-14H2
SMILES:c1ccnc(c1)CN1CCN(CC1)Cc1ccccn1
Synonyms:- Piperazine, 1,4-Bis(2-Pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
