CAS 65854-77-5
:2H-1,4-Benzodiazepin-2-one, 3-(acetyloxy)-7-chloro-1,3-dihydro-5-(phenyl-d5)-
Description:
The chemical substance known as "2H-1,4-Benzodiazepin-2-one, 3-(acetyloxy)-7-chloro-1,3-dihydro-5-(phenyl-d5)-" with CAS number 65854-77-5 is a derivative of benzodiazepine, a class of compounds known for their psychoactive properties. This specific compound features a benzodiazepine core structure, which includes a fused benzene and diazepine ring. The presence of an acetyloxy group at the 3-position and a chloro substituent at the 7-position contributes to its unique chemical reactivity and potential pharmacological effects. The incorporation of a phenyl-d5 group indicates the presence of deuterium-labeled phenyl, which can be useful in studies involving metabolic pathways or drug interactions. The compound's structure suggests it may exhibit properties typical of benzodiazepines, such as anxiolytic, sedative, or muscle relaxant effects, although specific biological activity would depend on further empirical studies. As with many benzodiazepines, safety and efficacy profiles would need to be established through rigorous testing.
Formula:C17H8ClD5N2O3
InChI:InChI=1S/C17H13ClN2O3/c1-10(21)23-17-16(22)19-14-8-7-12(18)9-13(14)15(20-17)11-5-3-2-4-6-11/h2-9,17H,1H3,(H,19,22)/i2D,3D,4D,5D,6D
InChI key:InChIKey=FYRWUTOZBRWYCS-VIQYUKPQSA-N
SMILES:O(C(C)=O)C1N=C(C=2C(NC1=O)=CC=C(Cl)C2)C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H]
Synonyms:- 2H-1,4-Benzodiazepin-2-one, 3-(acetyloxy)-7-chloro-1,3-dihydro-5-(phenyl-d5)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oxazepam-d5 Acetate
CAS:Controlled ProductApplications Oxazepam-d5 Acetate is the deuterated Oxazepam Acetate (O845710), a benzodiazepine derivative with anticonvulsant and muscle relaxant properties. An ester of Oxazepam (O845700).Controlled Substance.
References Klopman, G. et al.: Molec. Pharmacol., 27, 86 (1985); Maksay, G. et al.: J. med. Chem., 24, 499 (1981)Formula:C17H8D5ClN2O3Color and Shape:NeatMolecular weight:333.78
