CymitQuimica logo

CAS 65860-38-0

:

1,6-dihydroxy-5-(hydroxymethyl)-N-(propan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-aminium chloride

Description:
1,6-Dihydroxy-5-(hydroxymethyl)-N-(propan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-aminium chloride, with the CAS number 65860-38-0, is a quaternary ammonium compound characterized by its complex structure, which includes a tetrahydronaphthalene core substituted with hydroxyl and hydroxymethyl groups. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can impart antimicrobial activity and enhance solubility in aqueous solutions. Its hydroxyl groups contribute to potential hydrogen bonding, influencing its solubility and reactivity. The presence of the isopropyl group may enhance its lipophilicity, making it suitable for various applications in pharmaceuticals and as a surfactant in formulations. Additionally, the chloride ion serves as a counterion, which can affect the compound's stability and interaction with other substances. Overall, this compound's unique structural features suggest potential utility in diverse chemical and biological applications, although specific applications would depend on further research and characterization.
Formula:C14H22ClNO3
InChI:InChI=1/C14H21NO3.ClH/c1-8(2)15-12-5-3-9-10(14(12)18)4-6-13(17)11(9)7-16;/h4,6,8,12,14-18H,3,5,7H2,1-2H3;1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.