CymitQuimica logo

CAS 65862-01-3

:

1-methyl bicyclo[1.1.1]pentane-3-carboxylic acid

Description:
1-Methyl bicyclo[1.1.1]pentane-3-carboxylic acid, identified by its CAS number 65862-01-3, is a bicyclic organic compound characterized by a unique bicyclo[1.1.1]pentane framework. This structure consists of a central pentane ring with two additional carbon atoms forming a bridge, resulting in a highly strained and rigid molecular configuration. The presence of a carboxylic acid functional group (-COOH) at the 3-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The methyl group at the 1-position introduces steric hindrance, influencing the compound's physical properties and reactivity. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to the carboxylic acid group, while their bicyclic structure can lead to unique conformational properties. Overall, 1-methyl bicyclo[1.1.1]pentane-3-carboxylic acid is of interest in organic synthesis and may have applications in medicinal chemistry and materials science due to its distinctive structural features.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c1-6-2-7(3-6,4-6)5(8)9/h2-4H2,1H3,(H,8,9)
InChI key:TUFJVYRDYWRNOL-UHFFFAOYSA-N
SMILES:CC12CC(C1)(C2)C(=O)O
Found 6 products.