CAS 65869-64-9

2,5-Pyrrolidinedione, 1,1′-[oxybis[(1-oxo-3,1-propanediyl)oxy]]bis-

Description:

2,5-Pyrrolidinedione, 1,1′-[oxybis[(1-oxo-3,1-propanediyl)oxy]]bis- is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple ether linkages. This substance is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols. It exhibits properties typical of diketones, including potential reactivity with nucleophiles due to the presence of carbonyl groups. The compound may be used in various applications, including as a reagent in organic synthesis or as an intermediate in the production of pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, 2,5-Pyrrolidinedione, 1,1′-[oxybis[(1-oxo-3,1-propanediyl)oxy]]bis- is a notable compound in the field of organic chemistry with potential utility in various chemical processes.

Formula: C₁₄H₁₆N₂O₉

InChI: InChI=1S/C14H16N2O9/c17-9-1-2-10(18)15(9)24-13(21)5-7-23-8-6-14(22)25-16-11(19)3-4-12(16)20/h1-8H2

InChI key: InChIKey=OWCYSDGIJAVHFQ-UHFFFAOYSA-N

SMILES: O(C(CCOCCC(ON1C(=O)CCC1=O)=O)=O)N2C(=O)CCC2=O

Synonyms:

• 2,5-Pyrrolidinedione, 1,1′-[oxybis[(1-oxo-3,1-propanediyl)oxy]]bis-

Bis(2,5-dioxopyrrolidin-1-yl) 3,3'-oxydipropanoate

CAS: 65869-64-9

Formula: C₁₄H₁₆N₂O₉

Purity: 95%

Color and Shape: Solid

Molecular weight: 356.2848

Ref: IN-DA003O86

Bis-PEG1-NHS ester

CAS: 65869-64-9

Bis-PEG1-NHS ester

Purity: 97%

Molecular weight: 356.28g/mol

Ref: 54-BIPG1262

Bis-PEG1-NHS ester

CAS: 65869-64-9

Bis-PEG1-NHS ester is a non-cleavable and 1-unit PEG ADC linker for the synthesis of antibody-coupled active molecules (ADCs).

Formula: C₁₄H₁₆N₂O₉

Purity: 98.22%

Color and Shape: Solid

Molecular weight: 356.29

Ref: TM-T14627

Bis-PEG1-NHS ester

CAS: 65869-64-9

Purity: 95%

Molecular weight: 356.09

Ref: 10-F554621