CAS 65877-63-6
:(2S,4S,5R)-4-benzyloxy-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol
Description:
The chemical substance known as (2S,4S,5R)-4-benzyloxy-6-(hydroxymethyl)tetrahydropyran-2,3,5-triol, with the CAS number 65877-63-6, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including a benzyloxy group and hydroxymethyl groups, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The stereochemistry indicated by the (2S,4S,5R) configuration suggests specific spatial arrangements of its substituents, which can significantly influence its biological activity and interactions with other molecules. The presence of hydroxyl groups makes it a polyol, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may be of interest in the development of pharmaceuticals or as an intermediate in the synthesis of more complex molecules due to its structural features and functional versatility. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.
Formula:C13H18O6
InChI:InChI=1/C13H18O6/c14-6-9-10(15)12(11(16)13(17)19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9?,10-,11?,12+,13+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-O-Benzyl-a-D-mannopyranose
CAS:3-O-Benzyl-a-D-mannopyranose is a sugar that is used in the synthesis of complex carbohydrates. It is a synthetic compound that can be fluorinated, glycosylated, or methylated to produce desired compounds. 3-O-Benzyl-a-D-mannopyranose has a CAS number of 65877-63-6 and can be used in the synthesis of oligosaccharides, monosaccharides, and saccharides. This product has high purity and is available for custom synthesis.Formula:C13H18O6Purity:Min. 95%Molecular weight:270.28 g/mol

