CAS 65882-39-5

N,N,7-Trimethyl-1H-indole-3-ethanamine

Description:

N,N,7-Trimethyl-1H-indole-3-ethanamine, with the CAS number 65882-39-5, is a chemical compound that belongs to the class of indole derivatives. This substance features a core indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the trimethyl group at the nitrogen atom and the ethylamine side chain contributes to its unique properties. Typically, compounds of this nature may exhibit biological activity, potentially interacting with neurotransmitter systems due to their structural similarity to various neurotransmitters. The trimethyl substitution can influence the compound's lipophilicity, solubility, and overall pharmacokinetic profile. Additionally, the indole framework is known for its role in various natural products and pharmaceuticals, making such derivatives of interest in medicinal chemistry. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the presence of functional groups.

Formula: C₁₃H₁₈N₂

InChI: InChI=1/C13H18N2/c1-10-5-4-6-12-11(7-8-15(2)3)9-14-13(10)12/h4-6,9,14H,7-8H2,1-3H3

InChI key: InChIKey=PQSFTUCFMWBITK-UHFFFAOYSA-N

SMILES: C(CN(C)C)C=1C=2C(NC1)=C(C)C=CC2

Synonyms:

• 1H-Indole-3-ethanamine, N,N,7-trimethyl-
• N,N,7-Trimethyl-1H-indole-3-ethanamine
• 7-Methyl DMT

7-Methyl DMT

CAS: 65882-39-5

7-Methyl DMT (7-TMT) acts as a 5-HT2 receptor agonist. Structurally, it is a tryptamine derivative and serves as an analytical reference for the psychoactive substance DOM. It is also applicable in research related to neurological disorders.

Formula: C₁₃H₁₈N₂

Color and Shape: Solid

Molecular weight: 202.3

Ref: TM-T203196