CAS 65892-76-4

(3β,4β,22β)-22-Methoxyolean-13(18)-ene-3,23-diol

Description:

(3β,4β,22β)-22-Methoxyolean-13(18)-ene-3,23-diol, with the CAS number 65892-76-4, is a triterpenoid compound characterized by its complex structure, which includes multiple hydroxyl groups and a methoxy substituent. This compound belongs to the oleanane family, which is known for its presence in various plants and its potential biological activities. The presence of hydroxyl groups contributes to its solubility in polar solvents and may enhance its reactivity, making it a candidate for various chemical transformations. Triterpenoids like this one are often studied for their pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The specific stereochemistry indicated by the nomenclature suggests that the compound has distinct spatial arrangements that can influence its biological interactions and efficacy. Overall, (3β,4β,22β)-22-Methoxyolean-13(18)-ene-3,23-diol represents a significant area of interest in natural product chemistry and medicinal research.

Formula: C₃₁H₅₂O₃

InChI: InChI=1S/C31H52O3/c1-26(2)17-21-20-9-10-23-28(4)13-12-24(33)29(5,19-32)22(28)11-14-31(23,7)30(20,6)16-15-27(21,3)25(18-26)34-8/h22-25,32-33H,9-19H2,1-8H3/t22-,23-,24+,25-,27-,28+,29-,30-,31-/m1/s1

InChI key: InChIKey=JAQZKPHHLRTVCY-ZHRKTGFNSA-N

SMILES: C[C@]12[C@@]3(C)C(=C4[C@@](C)(CC3)[C@H](OC)CC(C)(C)C4)CC[C@@]1([C@]5(C)[C@@](CC2)([C@](CO)(C)[C@@H](O)CC5)[H])[H]

Synonyms:

• Olean-13(18)-ene-3,23-diol, 22-methoxy-, (3β,4β,22β)-
• (3β,4β,22β)-22-Methoxyolean-13(18)-ene-3,23-diol
• Soyasapogenol D

Soyasapogenol D

CAS: 65892-76-4

Soyasapogenol D is a natural product

Formula: C₃₁H₅₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.74

Ref: TM-TN2227

Soyasapogenol D

CAS: 65892-76-4

Formula: C₃₁H₅₂O₃

Purity: 95%~99%

Molecular weight: 472.754

Ref: BP-BP4915

Soyasapogenol D

CAS: 65892-76-4

Soyasapogenol D is a bioactive compound, classified as a type of triterpenoid saponin. It is primarily derived from soybeans, a widely cultivated legume known for its rich composition of various phytochemicals. The mode of action of Soyasapogenol D involves its ability to interact with cellular pathways to modulate inflammatory responses and potentially influence lipid metabolism. Its structure allows it to integrate into biological membranes, affecting cellular signaling mechanisms.

Formula: C₃₁H₅₂O₃

Purity: Min. 95%

Molecular weight: 472.70 g/mol

Ref: 3D-QCA89276