CAS 659-18-7
:Ethanol, 2,2,2-trifluoro-, 1,1′,1′′-triester with boric acid (H3BO3)
Description:
Ethanol, 2,2,2-trifluoro-, 1,1′,1′′-triester with boric acid, commonly referred to by its CAS number 659-18-7, is a chemical compound characterized by its unique structure that includes trifluoromethyl groups and borate ester functionalities. This compound typically exhibits properties associated with both its fluorinated and boron-containing components, such as increased stability and potential hydrophobicity due to the presence of fluorine atoms. The trifluoromethyl groups can enhance the compound's lipophilicity and influence its reactivity, while the boric acid moiety can participate in various chemical interactions, including hydrogen bonding and coordination with other molecules. Ethanol serves as a solvent and a reactive site in the formation of esters, contributing to the compound's overall chemical behavior. This substance may find applications in fields such as organic synthesis, materials science, and potentially in pharmaceuticals, owing to its distinctive properties. However, specific safety and handling guidelines should be followed due to the potential hazards associated with fluorinated compounds and boron derivatives.
Formula:C6H6BF9O3
InChI:InChI=1/C6H6BF9O3/c8-4(9,10)1-17-7(18-2-5(11,12)13)19-3-6(14,15)16/h1-3H2
InChI key:InChIKey=DIEXQJFSUBBIRP-UHFFFAOYSA-N
SMILES:B(OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F
Synonyms:- Ethanol, 2,2,2-trifluoro-, borate
- Tris(2,2,2-trifluoroethyl) borate
- Ethanol, 2,2,2-trifluoro-, 1,1′,1′′-triester with boric acid (H3BO3)
- Tris(2,2,2-trifluoroethoxy)boron
- Ethanol, 2,2,2-trifluoro-, triester with boric acid (H3BO3)
- Ethanol, 2,2,2-trifluoro-, 1,1',1''-triester with boric acid (H3BO3)
- Tris(2,2,2-trifluoroethyl) borate 97+%
- TRIS(TRIFLUOROETHYL)BORATE
- Tris(2,2,2-trifluoroethyl) borate 98%
- Sheppard Amidation Reagent
- Tris(2,2,2-trifluoroethoxy)borane
- Boric Acid Tris(2,2,2-trifluoroethyl) Ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tris(2,2,2-trifluoroethyl) Borate
CAS:Formula:C6H6BF9O3Purity:>95.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:307.91Ethanol, 2,2,2-trifluoro-, triester with boric acid (H3BO3)
CAS:Formula:C6H6BF9O3Purity:95%Color and Shape:LiquidMolecular weight:307.9067Ref: IN-DA00IBJF
1g29.00€5g71.00€10g101.00€25g178.00€2kgTo inquire5kgTo inquire100g352.00€250gTo inquire500gTo inquire250mg20.00€Tris(2,2,2-trifluoroethyl) borate
CAS:Tris(2,2,2-trifluoroethyl) borateFormula:C6H6BF9O3Purity:97%Color and Shape: clear. colourless liquidMolecular weight:307.91g/molTris(2,2,2-trifluoroethyl) borate
CAS:Tris(2,2,2-trifluoroethyl) boratePurity:≥95%Molecular weight:307.91g/molTris(2,2,2-Fluoroethyl) borate
CAS:Formula:C6H6BF9O3Purity:95%Color and Shape:LiquidMolecular weight:307.91Tris(2,2,2-trifluoroethyl) borate
CAS:Tris(2,2,2-trifluoroethyl) borate (SL 75212) aids in creating amides and imines in condensation reactions.Formula:C6H6BF9O3Purity:98%Color and Shape:SolidMolecular weight:307.91




