CAS 6590-95-0: 2,6-Dichlorophenyl isothiocyanate
Description:2,6-Dichlorophenyl isothiocyanate is an organic compound characterized by its isothiocyanate functional group attached to a dichlorophenyl moiety. It typically appears as a yellow to brownish liquid or solid, depending on its purity and form. This compound is known for its pungent odor and is soluble in organic solvents such as acetone and chloroform, but has limited solubility in water. It is primarily used in chemical synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of chlorine atoms in the phenyl ring enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, 2,6-Dichlorophenyl isothiocyanate exhibits biological activity, which has led to its investigation in various fields, including medicinal chemistry and plant protection. However, it should be handled with care due to its potential toxicity and irritant properties. Proper safety measures, including the use of personal protective equipment, are essential when working with this compound.
Formula:C7H3Cl2NS
InChI:InChI=1S/C7H3Cl2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H
InChI key:InChIKey=SUCGVQHNGIQXGD-UHFFFAOYSA-N
SMILES:S=C=NC=1C(Cl)=CC=CC1Cl
- Synonyms:
- 1,3-Dichloro-2-Isothiocyanatobenzene
- 2,6-Dichloro Phenyl Isothiocynate
- 2,6-Dichloroisothiocyanatobenzene
- Benzene, 1,3-dichloro-2-isothiocyanato-
- Isothiocyanic acid, 2,6-dichlorophenyl ester
- 2,6-Dichlorophenyl isothiocyanate
2,6-Dichlorophenyl isothiocyanate, 98+%
Ref: 02-L12672
| 1g | To inquire | ||
| 5g | To inquire |
2,6-DICHLOROPHENYL ISOTHIOCYANATE
Ref: IN-DA003G3O
| 1g | 54.00 € | ||
| 100mg | 51.00 € |
Ref: 54-OR315263
| 1g | 32.00 € | ||
| 5g | 63.00 € | ||
| 25g | 261.00 € | ||
| 100g | 755.00 € | ||
| 500g | 3,151.00 € |
2,6-Dichlorophenylisothiocyanate
Ref: 10-F008814
| 1g | 43.00 € | ||
| 5g | 55.00 € | ||
| 100mg | 37.00 € |
2,6-Dichlorophenylisothiocyanate
Ref: 3D-GAA59095
| 250mg | 331.00 € | ||
| 2500mg | 911.00 € |
