CAS 65902-59-2
:2-Bromo-4-nitroimidazole
Description:
2-Bromo-4-nitroimidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the second position and a nitro group at the fourth position of the imidazole ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals, particularly as an antimicrobial agent or in the development of various therapeutic agents. Its reactivity can be attributed to the electron-withdrawing effects of the nitro group, which can influence its behavior in chemical reactions. Additionally, the bromine substituent can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Bromo-4-nitroimidazole is a significant compound in medicinal chemistry and organic synthesis.
Formula:C3H2BrN3O2
InChI:InChI=1S/C3H2BrN3O2/c4-3-5-1-2(6-3)7(8)9/h1H,(H,5,6)
InChI key:InChIKey=UWRJWMLKEHRGOH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1NC(Br)=NC1
Synonyms:- 1H-Imidazole, 2-bromo-4-nitro-
- 1H-Imidazole, 2-bromo-5-nitro-
- 2-Bromo-4-nitoimidazole
- 2-Bromo-4-nitro-1H-imidazole
- 2-bromo-5-nitro-1H-imidazole
- 2-Bromo-4-nitroimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Bromo-4-nitroimidazole
CAS:Formula:C3H2BrN3O2Purity:>98.0%(GC)Color and Shape:White to Yellow powder to crystalMolecular weight:191.972-Bromo-5-nitroimidazole, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C3H2BrN3O2Purity:98%Molecular weight:191.972-Bromo-4-nitro-3H-imidazole
CAS:Formula:C3H2BrN3O2Purity:97%Color and Shape:SolidMolecular weight:191.97092-Bromo-4-nitroimidazole
CAS:Formula:C3H2BrN3O2Purity:≥ 98.0%Color and Shape:Off-white to light yellow powderMolecular weight:191.972-Bromo-4-nitro-1H-imidazole
CAS:2-Bromo-4-nitro-1H-imidazoleFormula:C3H2BrN3O2Purity:97%Color and Shape: faint yellow solidMolecular weight:191.97088g/mol2-Bromo-5-nitro-1H-imidazole
CAS:Formula:C3H2BrN3O2Purity:97%Color and Shape:SolidMolecular weight:191.9722-Bromo-4-nitroimidazole
CAS:<p>2-Bromo-4-nitroimidazole is a chemical compound with the molecular formula C6H5BrNO2. It is an amide containing a nitroimidazole functional group. 2-Bromo-4-nitroimidazole can be used to synthesize pretomanid, which is an anti-tuberculosis drug. Pretomanid inhibits the growth of Mycobacterium tuberculosis by inhibiting protein synthesis and cell division. The active form of pretomanid has been shown to be hydrolyzed by hydrochloric acid and organic acids such as acetylcholinesterase and carboxypeptidase A. Pretomanid also binds to chloride ions, which may account for its ability to inhibit bacterial growth in acidic environments such as those found in the human stomach.</p>Formula:C3H2BrN3O2Purity:Min. 95%Molecular weight:191.97 g/mol







