CAS 65907-76-8

Danshenxinkun B

Description:

Danshenxinkun B, with the CAS number 65907-76-8, is a chemical compound derived from traditional Chinese medicinal herbs, particularly from the Salvia miltiorrhiza plant, commonly known as Danshen. This compound is recognized for its potential pharmacological properties, including antioxidant, anti-inflammatory, and cardioprotective effects. Danshenxinkun B is often studied for its role in promoting cardiovascular health and its ability to improve blood circulation. The compound is characterized by its complex molecular structure, which contributes to its biological activity. It is typically analyzed using various techniques such as chromatography and spectroscopy to determine its purity and concentration in herbal formulations. Research into Danshenxinkun B continues to explore its mechanisms of action and therapeutic applications, particularly in the context of cardiovascular diseases and other health conditions. As with many natural products, the efficacy and safety of Danshenxinkun B depend on factors such as dosage, formulation, and individual patient characteristics.

Formula: C₁₈H₁₆O₃

InChI: InChI=1S/C18H16O3/c1-9(2)14-16(19)13-8-7-11-10(3)5-4-6-12(11)15(13)18(21)17(14)20/h4-9,20H,1-3H3

InChI key: InChIKey=XUJXNYAIAKCUMO-UHFFFAOYSA-N

SMILES: O=C1C=2C=3C(C=CC2C(=O)C(C(C)C)=C1O)=C(C)C=CC3

Synonyms:

• 1,4-Phenanthrenedione, 3-hydroxy-8-methyl-2-(1-methylethyl)-
• Danshenxinkun B
• 3-Hydroxy-8-methyl-2-(1-methylethyl)-1,4-phenanthrenedione

3-Hydroxy-2-isopropyl-8-methyl-1,4-phenanthrenedione

CAS: 65907-76-8

Formula: C₁₈H₁₆O₃

Molecular weight: 280.3178

Ref: IN-DA00FHND

Danshenxinkun B

CAS: 65907-76-8

Danshenxinkun B has antioxIdant activity, it may have the potential of being used as natural antioxidants in foods and cosmetics.

Formula: C₁₈H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.32

Ref: TM-TN1551

Danshenxinkun B

CAS: 65907-76-8

Formula: C₁₈H₁₆O₃

Molecular weight: 280.32

Ref: 7W-GY7295

Danshenxinkun B

CAS: 65907-76-8

Formula: C₁₈H₁₆O₃

Purity: 95%~99%

Molecular weight: 280.323

Ref: BP-BP1861

Danshenxinkun B

CAS: 65907-76-8

Danshenxinkun B is an herbal formulation, which is derived from the roots of the Salvia miltiorrhiza plant, commonly known as Danshen. This source is a well-documented traditional Chinese medicinal herb, renowned for its bioactive compounds such as tanshinones and salvianolic acids. These compounds exhibit pharmacological properties that enhance cardiovascular health by promoting vasodilation, reducing oxidative stress, and inhibiting platelet aggregation.

Formula: C₁₈H₁₆O₃

Purity: Min. 95%

Molecular weight: 280.3 g/mol

Ref: 3D-QCA90776