CAS 65914-17-2: Polydatin
Description:Polydatin, with the CAS number 65914-17-2, is a natural compound classified as a stilbene glycoside, primarily found in various plants, including the roots of Polygonum cuspidatum. It is a derivative of resveratrol, featuring a glucose moiety attached to the resveratrol structure. Polydatin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects. Its chemical structure contributes to its ability to scavenge free radicals and modulate various signaling pathways, which may have implications for health benefits, particularly in cardiovascular and metabolic conditions. Additionally, polydatin has been studied for its potential anticancer properties, as it may inhibit tumor growth and induce apoptosis in certain cancer cell lines. The compound is soluble in water and organic solvents, making it versatile for various applications in research and potential therapeutic uses. Overall, polydatin is of significant interest in pharmacology and nutraceuticals due to its promising health-related properties.
Formula:C21H24O8
InChI:InChI=1/C21H24O8/c1-27-15-6-4-12(5-7-15)2-3-13-8-14(23)10-16(9-13)28-21-20(26)19(25)18(24)17(11-22)29-21/h2-10,17-26H,11H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1
- Synonyms:
- 3, 5, 4'-Trihydroxystilbene 3-glucoside
- 3-Hydroxy-5-[(1E)-2-(4-hydroxyphenyl)ethenyl]phenyl-beta-D-glucopyranoside
- Piceid
- 3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl beta-D-glucopyranoside
- 3-hydroxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl beta-D-glucopyranoside