CAS 65914-17-2
:Polydatin
Description:
Polydatin, with the CAS number 65914-17-2, is a natural compound classified as a stilbene glycoside, primarily found in various plants, including the roots of Polygonum cuspidatum. It is a derivative of resveratrol, featuring a glucose moiety attached to the resveratrol structure. Polydatin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects. Its chemical structure contributes to its ability to scavenge free radicals and modulate various signaling pathways, which may have implications for health benefits, particularly in cardiovascular and metabolic conditions. Additionally, polydatin has been studied for its potential anticancer properties, as it may inhibit tumor growth and induce apoptosis in certain cancer cell lines. The compound is soluble in water and organic solvents, making it versatile for various applications in research and potential therapeutic uses. Overall, polydatin is of significant interest in pharmacology and nutraceuticals due to its promising health-related properties.
Formula:C21H24O8
InChI:InChI=1/C21H24O8/c1-27-15-6-4-12(5-7-15)2-3-13-8-14(23)10-16(9-13)28-21-20(26)19(25)18(24)17(11-22)29-21/h2-10,17-26H,11H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1
Synonyms:- 3, 5, 4'-Trihydroxystilbene 3-glucoside
- 3-Hydroxy-5-[(1E)-2-(4-hydroxyphenyl)ethenyl]phenyl-beta-D-glucopyranoside
- Piceid
- 3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl beta-D-glucopyranoside
- 3-hydroxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Piceid
CAS:Formula:C20H22O8Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:390.39b-D-Glucopyranoside, 3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl
CAS:Formula:C20H22O8Purity:%Color and Shape:SolidMolecular weight:390.3839(E/Z)-Polydatin
CAS:(E/Z)-Polydatin, a resveratrol glycoside from Picea/Polygonum, in grapes & chocolate, has anti-inflammatory and anti-cancer properties.Formula:C20H22O8Purity:98.78% - 99.16%Color and Shape:SolidMolecular weight:390.383,4'',5-Trihydroxystilbene-3-b-D-glucopyranoside
CAS:Formula:C20H22O8Purity:≥ 95%Color and Shape:White, off-white or pale brown powderMolecular weight:390.38Polydatin
CAS:Applications Polydatin is a Resveratrol glycoside and inhibitor of platelet aggregation.
Formula:C20H22O8Color and Shape:NeatMolecular weight:390.38(2S,3R,4S,5S,6R)-2-(3-Hydroxy-5-(4-hydroxystyryl)phenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
CAS:Formula:C20H22O8Purity:99+%Color and Shape:Solid, solidMolecular weight:390.3883,4',5-Trihydroxystilbene-3-b-D-glucopyranoside
CAS:3,4',5-Trihydroxystilbene-3-b-D-glucopyranoside is a resveratrol derivative, which is a type of polyphenolic compound. It is sourced naturally from plants such as Polygonum cuspidatum, commonly known as Japanese knotweed, where it acts as a phytoalexin. The compound is characterized by its glycosidic linkage to glucose, which enhances its solubility and stability compared to resveratrol itself.Formula:C20H22O8Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:390.38 g/mol









